2377167-56-9
Chemical Structure
HEI3090
- No. CAS: 2377167-56-9
- Formula:C18H15Cl3N4O3
- Molecular Weight:441.70
InChIKey: XFDLAUDFTNZPNJ-AWEZNQCLSA-N
SMILES: ClC1=NC=C(C=C1)NC(N2[C@@H](CCC2=O)C(NCC3=C(C=C(C=C3)Cl)Cl)=O)=O
Biological Activity: HEI3090 is a P2X7R activator. HEI3090 stimulates dendritic cells expressing P2X7R to produce IL-18, which subsequently promotes Natural Killer cells and CD4 T cells within tumors to produce IFN-γ, leading to a sustained antitumor response. HEI3090 can be used to enhance the efficacy of αPD-1 therapy in non-small cell lung cancer (NSCLC)[1].
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HEI3090 | 99.00% | HEI3090 is a P2X7R activator. HEI3090 stimulates dendritic cells expressing P2X7R to produce IL-18, which subsequently promotes Natural Killer cells and CD4 T cells within tumors to produce IFN-γ, leading to a sustained antitumor response. HEI3090 can be used to enhance the efficacy of αPD-1 therapy in non-small cell lung cancer (NSCLC). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords