2378379-27-0
Chemical Structure
Asperaculane B
- CAS No.: 2378379-27-0
- Formula:C14H20O3
- Molecular Weight:236.31
IUPAC Name: (3aR,8S,8aR)-3-ethyl-8-hydroxy-6-(hydroxymethyl)-8a-methyl-4,7,8,8a-tetrahydroazulen-1(3aH)-one
InChIKey: GFYHPKUYDFUKNL-MBNYWOFBSA-N
SMILES: CCC1=CC([C@]2(C)[C@@H]1CC=C(CO)C[C@@H]2O)=O
Biological Activity: Asperaculane B is a fungal metabolite against P. falciparum transmission with an IC50 of 7.89 µM. Asperaculane B also inhibits the development of asexual P. falciparum with IC50 of 3 µM, and it is nontoxic to human cells[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Asperaculane B | Asperaculane B is a fungal metabolite against P. falciparum transmission with an IC50 of 7.89 µM. Asperaculane B also inhibits the development of asexual P. falciparum with IC50 of 3 µM, and it is nontoxic to human cells. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords