2408835-49-2
Chemical Structure
His-TERRα
- CAS No.: 2408835-49-2
- Formula:C31H28F3N9O5S
- Molecular Weight:695.67
InChIKey: WNHOAIQLHBNJGA-BMJWKCNQSA-N
SMILES: FC(F)(F)C(C=C(C=C1)C#N)=C1OC2=C(C=C(C=C2)/C=C3C(N(C(S\3)=O)CC4=CN(N=N4)CCCNC([C@@H](N)CC5=CN=CN5)=O)=O)OC
Biological Activity: His-TERRα is a ERRα PROTAC degrader. His-TERRα uses a single amino acid (His) as the E3 ligand and employs the N-end rule pathway to induce the degradation of the target protein, significantly reducing the molecular size, and thus is called a mini-PROTAC. His-TERRα significantly inhibits the proliferation and migration of MCF7 breast cancer cells. His-TERRα can be used for the study of breast cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
His-TERRα | His-TERRα is a ERRα PROTAC degrader. His-TERRα uses a single amino acid (His) as the E3 ligand and employs the N-end rule pathway to induce the degradation of the target protein, significantly reducing the molecular size, and thus is called a mini-PROTAC. His-TERRα significantly inhibits the proliferation and migration of MCF7 breast cancer cells. His-TERRα can be used for the study of breast cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
