2413192-92-2
Chemical Structure
HBV-IN-30
- CAS No.: 2413192-92-2
- Formula:C22H18BrClO6
- Molecular Weight:493.73
IUPAC Name: (1s,3s)-3-(2-(2-bromo-4-(8-chloro-4-oxo-4H-chromen-2-yl)phenoxy)ethoxy)cyclobutane-1-carboxylic acid
InChIKey: LPNIROGMUQBBSZ-OKILXGFUSA-N
SMILES: ClC1=C2C(C(C=C(C3=CC(Br)=C(C=C3)OCCO[C@@H]4C[C@@H](C4)C(O)=O)O2)=O)=CC=C1
Biological Activity: HBV-IN-30 (ex44), a flavone derivative, is a potent covalently closed circular DNA (cccDNA) inhibitor. cccDNA serves as the template for viral RNA transcription and subsequent viral DNA generation. HBV-IN-30 has the potential for the research of HBV infection[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HBV-IN-30 | HBV-IN-30 (ex44), a flavone derivative, is a potent covalently closed circular DNA (cccDNA) inhibitor. cccDNA serves as the template for viral RNA transcription and subsequent viral DNA generation. HBV-IN-30 has the potential for the research of HBV infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||