24259-59-4
Chemical Structure
L-Ribose
- CAS No.: 24259-59-4
- Formula:C5H10O5
- Molecular Weight:150.13
IUPAC Name: (2S,3S,4S)-2,3,4,5-tetrahydroxypentanal
InChIKey: PYMYPHUHKUWMLA-MROZADKFSA-N
SMILES: O=C[C@H]([C@H]([C@H](CO)O)O)O
Biological Activity: L-Ribose is the enantiomer of D-ribose (HY-113375). L-Ribose replaces D-ribose to synthesize L-ribonucleic acid in cells, leading to erroneous gene transcription. L-Ribose serves as a starting material for L-nucleoside analogs, glycoconjugates and oligonucleotides. L-Ribose can be used in research related to hepatitis B virus infection, hepatitis C virus infection, hepatitis D virus infection, Epstein-Barr virus infection and cytomegalovirus infection[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
L-Ribose | 98.0% | L-Ribose is the enantiomer of D-ribose (HY-113375). L-Ribose replaces D-ribose to synthesize L-ribonucleic acid in cells, leading to erroneous gene transcription. L-Ribose serves as a starting material for L-nucleoside analogs, glycoconjugates and oligonucleotides. L-Ribose can be used in research related to hepatitis B virus infection, hepatitis C virus infection, hepatitis D virus infection, Epstein-Barr virus infection and cytomegalovirus infection. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Ribose (Standard) | ≥98% | L-Ribose (Standard) is the analytical standard of L-Ribose (HY-W008351). This product is intended for research and analytical applications. L-Ribose is the enantiomer of D-ribose (HY-113375). L-Ribose replaces D-ribose to synthesize L-ribonucleic acid in cells, leading to erroneous gene transcription. L-Ribose serves as a starting material for L-nucleoside analogs, glycoconjugates and oligonucleotides. L-Ribose can be used in research related to hepatitis B virus infection, hepatitis C virus infection, hepatitis D virus infection, Epstein-Barr virus infection and cytomegalovirus infection. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
L-Ribose-13C | L-Ribose-13C is the 13C-labeled L-Ribose (HY-W008351). L-Ribose is the enantiomer of D-ribose (HY-113375). L-Ribose replaces D-ribose to synthesize L-ribonucleic acid in cells, leading to erroneous gene transcription. L-Ribose serves as a starting material for L-nucleoside analogs, glycoconjugates and oligonucleotides. L-Ribose can be used in research related to hepatitis B virus infection, hepatitis C virus infection, hepatitis D virus infection, Epstein-Barr virus infection and cytomegalovirus infection. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
