24541-43-3
Chemical Structure
4-Azidophenol
Synonym(s): p-Azidophenol
- CAS No.: 24541-43-3
- Formula:C6H5N3O
- Molecular Weight:135.12
IUPAC Name: 4-azidophenol
InChIKey: ABSZNIJDTSIVHN-UHFFFAOYSA-N
SMILES: C1=C(C=CC(=C1)O)N=[N+]=[N-]
Biological Activity: 4-Azidophenol (p-Azidophenol) is a click chemistry reagent containing an azide group that can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. 4-Azidophenol can also react with molecules containing DBCO or BCN groups through strain-promoted azide-alkyne cycloaddition (SPAAC)[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
4-Azidophenol | 99.83% | 4-Azidophenol (p-Azidophenol) is a click chemistry reagent containing an azide group that can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing alkyne groups. 4-Azidophenol can also react with molecules containing DBCO or BCN groups through strain-promoted azide-alkyne cycloaddition (SPAAC). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||