2490429-83-7
Chemical Structure
HIPS probe-1
- CAS No.: 2490429-83-7
- Formula:C13H15N3
- Molecular Weight:213.28
SMILES: C#CCN1C2=C(C=C1CN(C)N)C=CC=C2
Biological Activity: HIPS probe-1 (Compound 1) is a click chemistry reagent containing a alkyne group. HIPS probe-1 can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. HIPS probe-1 can be used as a chemical probe to specifically recognize and label aldehyde functional groups in DNA, especially abasic sites (AP sites) for DNA damage research[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HIPS probe-1 | 95.04% | HIPS probe-1 (Compound 1) is a click chemistry reagent containing a alkyne group. HIPS probe-1 can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. HIPS probe-1 can be used as a chemical probe to specifically recognize and label aldehyde functional groups in DNA, especially abasic sites (AP sites) for DNA damage research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||