2574593-54-5
Chemical Structure
c-ABL-IN-2
- CAS No.: 2574593-54-5
- Formula:C21H20N4O
- Molecular Weight:344.41
IUPAC Name: N-(1-isopropyl-1H-imidazol-4-yl)-4-methyl-3-(pyridin-3-ylethynyl)benzamide
InChIKey: GKJBFICXNCICKT-UHFFFAOYSA-N
SMILES: O=C(NC1=CN(C(C)C)C=N1)C2=CC=C(C)C(C#CC3=CC=CN=C3)=C2
Biological Activity: c-ABL-IN-2 is a potent inhibitor of c-Abl. Activation of c-Abl has been implicated in various diseases, notably cancer. c-ABL-IN-2 has the potential for the research of neurodegenerative diseases (amyotrophic lateral sclerosis (ALS) and Parkinson’s disease (PD) and cancer (extracted from patent WO2020260871A1, compound 25)[1]. c-ABL-IN-2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
c-ABL-IN-2 | c-ABL-IN-2 is a potent inhibitor of c-Abl. Activation of c-Abl has been implicated in various diseases, notably cancer. c-ABL-IN-2 has the potential for the research of neurodegenerative diseases (amyotrophic lateral sclerosis (ALS) and Parkinson’s disease (PD) and cancer (extracted from patent WO2020260871A1, compound 25). c-ABL-IN-2 is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||