2650846-59-4
Chemical Structure
OSM-S-106
- CAS No.: 2650846-59-4
- Formula:C12H10N4O2S2
- Molecular Weight:306.36
InChIKey: MQMXDJVOZKMSNT-UHFFFAOYSA-N
SMILES: NC1=C2C(C=C(C3=CC(S(N)(=O)=O)=CC=C3)S2)=NC=N1
Biological Activity: OSM-S-106 is a species-selective reaction hijacking pro-inhibitor targeting the cytosolic asparaginyl-tRNA synthetase (PfAsnRS) of Plasmodium falciparum. OSM-S-106 undergoes PfAsnRS-mediated reaction hijacking to form the Asn-OSM-S-106 adduct, which blocks the PfAsnRS catalytic cycle, inhibits protein translation, and activates the amino acid starvation response. OSM-S-106 is useful for research on malaria, PfAsnRS, and the reaction hijacking mechanism of aminoacyl-tRNA synthetases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
OSM-S-106 | 99.34% | OSM-S-106 is a species-selective reaction hijacking pro-inhibitor targeting the cytosolic asparaginyl-tRNA synthetase (PfAsnRS) of Plasmodium falciparum. OSM-S-106 undergoes PfAsnRS-mediated reaction hijacking to form the Asn-OSM-S-106 adduct, which blocks the PfAsnRS catalytic cycle, inhibits protein translation, and activates the amino acid starvation response. OSM-S-106 is useful for research on malaria, PfAsnRS, and the reaction hijacking mechanism of aminoacyl-tRNA synthetases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
