2733722-92-2
2733722-92-2
Chemical Structure
N-Nitroso-N-methylurea-d5
- CAS No.: 2733722-92-2
- Formula:C2D5N3O2
- Molecular Weight:108.11
InChIKey: ZRKWMRDKSOPRRS-OMNVKBNWSA-N
SMILES: O=C(N(C([2H])([2H])[2H])N=O)N([2H])[2H]
Biological Activity: N-Nitroso-N-methylurea-d5 is the deuterium labeled N-Nitroso-N-methylurea (HY-34758). N-Nitroso-N-methylurea (NMU;MNU;NMH) is a potent carcinogen, mutagen and teratogenand. N-Nitroso-N-methylurea is a direct-acting alkylating agent that interacts with DNA. N-Nitroso-N-methylurea targets multiple animal organs to cause various cancer and/or degenerative disease. N-Nitroso-N-methylurea is also a precursor in the synthesis of diazomethane[1][2][3][4].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
N-Nitroso-N-methylurea-d5 | N-Nitroso-N-methylurea-d5 is the deuterium labeled N-Nitroso-N-methylurea (HY-34758). N-Nitroso-N-methylurea (NMU;MNU;NMH) is a potent carcinogen, mutagen and teratogenand. N-Nitroso-N-methylurea is a direct-acting alkylating agent that interacts with DNA. N-Nitroso-N-methylurea targets multiple animal organs to cause various cancer and/or degenerative disease. N-Nitroso-N-methylurea is also a precursor in the synthesis of diazomethane. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
N-Nitroso-N-methylurea | 99.74% | N-Nitroso-N-methylurea (NMU;MNU;NMH) is a potent carcinogen, mutagen and teratogenand. N-Nitroso-N-methylurea is a direct-acting alkylating agent that interacts with DNA. N-Nitroso-N-methylurea targets multiple animal organs to cause various cancer and/or degenerative disease. N-Nitroso-N-methylurea is also a precursor in the synthesis of diazomethane. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
