274250-28-1
274250-28-1
Chemical Structure
Dansyl chloride-13C2
Synonym(s): DNSCl-13C2
- CAS No.: 274250-28-1
- Formula:C1013C2H12ClNO2S
- Molecular Weight:271.73
IUPAC Name: 1H-indole-13C8-15N
InChIKey: XPDXVDYUQZHFPV-ZDOIIHCHSA-N
SMILES: ClS(=O)(C1=CC=CC2=C1C=CC=C2N([13CH3])[13CH3])=O
Biological Activity: Dansyl chloride-13C2 is the 13C labeled Dansyl chloride (HY-D0017)[1]. Dansyl chloride is a reagent that produces stable blue or blue-green fluorescent sulfonamide adducts in the reaction of aliphatic and aromatic amines with primary amino groups, and is widely used for modified amino acids, protein sequencing and amino acid analysis.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dansyl chloride-13C2 | Dansyl chloride-13C2 is the 13C labeled Dansyl chloride (HY-D0017). Dansyl chloride is a reagent that produces stable blue or blue-green fluorescent sulfonamide adducts in the reaction of aliphatic and aromatic amines with primary amino groups, and is widely used for modified amino acids, protein sequencing and amino acid analysis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dansyl chloride-d6 | 98.0% | Dansyl chloride-d6 is the deuterium labeled Dansyl chloride (HY-D0017). Dansyl chloride is a reagent that produces stable blue or blue-green fluorescent sulfonamide adducts in the reaction of aliphatic and aromatic amines with primary amino groups, and is widely used for modified amino acids, protein sequencing and amino acid analysis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Dansyl chloride | 99.99% | Dansyl chloride is a reagent that produces stable blue or blue-green fluorescent sulfonamide adducts in the reaction of aliphatic and aromatic amines with primary amino groups, and is widely used for modified amino acids, protein sequencing and amino acid analysis. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
