27832-84-4
Chemical Structure
Serratenediol diacetate
- CAS. Nr.: 27832-84-4
- Formula:C34H54O4
- Molecular Weight:526.79
IUPAC Name: (3S,4aR,6aS,9aR,11S,13aR,13bS,15aS,15bR)-4,4,6a,10,10,13a,15b-heptamethyl-2,3,4,4a,5,6,6a,7,9,9a,10,11,12,13,13a,13b,14,15,15a,15b-icosahydro-1H-cyclohepta[1,2-a:5,4-a']dinaphthalene-3,11-diyl diacetate
InChIKey: BTPGAEAWTQOUIO-CXEBUEIGSA-N
SMILES: O=C(C)O[C@@H]1C(C)(C)[C@@](CC=C2[C@]3([H])CC[C@@]4([H])[C@](CC[C@](C(C)(C)[C@@H](OC(C)=O)CC5)([H])[C@@]45C)(C)C2)([H])[C@]3(C)CC1
Biological Activity: Serratenediol diacetate is a serratane-type triterpenoid compound, mainly used as a derivative of natural triterpenoids in natural product chemistry research and potential bioactivity screening. Serratenediol diacetate can be prepared from serratenediol isolated from Lycopodium complanatum L. (a plant of the Lycopodiaceae family, genus Lycopodium)[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Serratenediol diacetate | Serratenediol diacetate is a serratane-type triterpenoid compound, mainly used as a derivative of natural triterpenoids in natural product chemistry research and potential bioactivity screening. Serratenediol diacetate can be prepared from serratenediol isolated from Lycopodium complanatum L. (a plant of the Lycopodiaceae family, genus Lycopodium). | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
