28631-66-5
Chemical Structure
Aniline Blue sodium
- CAS No.: 28631-66-5
- Formula:C32H25N3Na2O9S3
- Molecular Weight:737.73
IUPAC Name: sodium 2-amino-3-methyl-5-((E)-(4-((4-sulfonatophenyl)amino)phenyl)((E)-4-((4-sulfophenyl)imino)cyclohexa-2,5-dien-1-ylidene)methyl)benzenesulfonate
InChIKey: XOSXWYQMOYSSKB-LDKJGXKFSA-L
SMILES: CC1=CC(/C(C2=CC=C(NC3=CC=C(S(=O)(O[Na])=O)C=C3)C=C2)=C4C=C/C(C=C\4)=N/C5=CC=C(S(=O)(O)=O)C=C5)=CC(S(=O)(O[Na])=O)=C1N
Biological Activity: Aniline Blue sodium is a water-soluble dye commonly used as a biological stain for the detection of nucleic acids and proteins in various laboratory procedures such as electrophoresis and microscopy. Aniline Blue sodium has unique chemical properties that allow it to bind to specific cellular components, producing a color change that facilitates their visualization and analysis.
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Aniline Blue sodium | Aniline Blue sodium is a water-soluble dye commonly used as a biological stain for the detection of nucleic acids and proteins in various laboratory procedures such as electrophoresis and microscopy. Aniline Blue sodium has unique chemical properties that allow it to bind to specific cellular components, producing a color change that facilitates their visualization and analysis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||