2897641-09-5
Chemical Structure
Tucatinib analog B
- CAS No.: 2897641-09-5
- Formula:C29H32N8O3
- Molecular Weight:540.62
InChIKey: QDSBUXCESYZASX-UHFFFAOYSA-N
SMILES: CC1=CC(NC2=C(C=C3OC)C(C=C3OCCCN4CCNCC4)=NC=N2)=CC=C1OC5=CC6=NC=NN6C=C5
Biological Activity: Tucatinib analog B is a HER2 ligand and a derivative of Tucatinib (HY-16069). Tucatinib analog B can be used in the synthesis of PROTAC degraders, such as serving as the target protein ligand for PROTAC HER2 degrader-1 (HY-177008). Tucatinib analog B is applicable to studies related to HER2-positive cancers[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Tucatinib analog B | Tucatinib analog B is a HER2 ligand and a derivative of Tucatinib (HY-16069). Tucatinib analog B can be used in the synthesis of PROTAC degraders, such as serving as the target protein ligand for PROTAC HER2 degrader-1 (HY-177008). Tucatinib analog B is applicable to studies related to HER2-positive cancers. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||