291535-65-4
Chemical Structure
Shegansu B
Synonym(s): (+)-Shegansu B; Parvifolol D
- CAS No.: 291535-65-4
- Formula:C30H26O8
- Molecular Weight:514.52
IUPAC Name: 5-((E)-2-((2S,3S)-3-(3,5-dihydroxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-2,3-dihydrobenzofuran-5-yl)vinyl)benzene-1,3-diol
InChIKey: JZRNLEJUOUYRLZ-ZEALOZJZSA-N
SMILES: COC1=C2C([C@@](C3=CC(O)=CC(O)=C3)([H])[C@](C(C=C4)=CC(OC)=C4O)([H])O2)=CC(/C=C/C5=CC(O)=CC(O)=C5)=C1
Biological Activity: Shegansu B is an inhibitor of IL-1β. Shegansu B 6 inhibits IL-1β expression on LPS-induced THP-1 cells with 64.74% inhibition. Shegansu B has anti-inflammatory activity[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Shegansu B | Shegansu B is an inhibitor of IL-1β. Shegansu B 6 inhibits IL-1β expression on LPS-induced THP-1 cells with 64.74% inhibition. Shegansu B has anti-inflammatory activity. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||