2923120-30-1
Chemical Structure
CCKBR agonist-1
- CAS No.: 2923120-30-1
- Formula:C32H39BrN6O7
- Molecular Weight:699.59
InChIKey: MUNNSMXBFGKXRU-FWEHEUNISA-N
SMILES: O=C(N[C@@H](CC1=CNC2=CC=CC=C12)C(N[C@@H](CCCC)C(N[C@@H](CC(O)=O)C(N[C@@H](CC3=CC(Br)=CC=C3)C(N)=O)=O)=O)=O)C
Biological Activity: CCKBR agonist-1 (Compound 3r1) is a Gq-protein-preferring cholecystokinin B receptor (CCKBR) agonist with an EC50 of 35 pM. CCKBR agonist-1 significantly increases the survival rate of neurons, with an EC50 of 37 pM. CCKBR agonist-1 can improve the cognitive decline in mice by upregulating α-secretase (ADAM10) and calcium signaling molecule PLCB4, reduce the number of amyloid β (Aβ) plaques, and promote long-term potentiation (LTP). CCKBR agonist-1 can be used for the study of Alzheimer's disease[1].
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
CCKBR agonist-1 | 98.48% | CCKBR agonist-1 (Compound 3r1) is a Gq-protein-preferring cholecystokinin B receptor (CCKBR) agonist with an EC50 of 35 pM. CCKBR agonist-1 significantly increases the survival rate of neurons, with an EC50 of 37 pM. CCKBR agonist-1 can improve the cognitive decline in mice by upregulating α-secretase (ADAM10) and calcium signaling molecule PLCB4, reduce the number of amyloid β (Aβ) plaques, and promote long-term potentiation (LTP). CCKBR agonist-1 can be used for the study of Alzheimer's disease. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
