3002056-30-3
Chemical Structure
NST-628
- CAS No.: 3002056-30-3
- Formula:C22H18F2N4O5S
- Molecular Weight:488.46
InChIKey: YQSZJOABXRROQR-UHFFFAOYSA-N
SMILES: FC1=C(OC2=CC=C(C(C)=C(CC3=C(F)C(NS(NC)(=O)=O)=NC=C3)C(O4)=O)C4=C2)N=CC=C1
Biological Activity: NST-628 is a brain-permeable MAPK pathway molecule glue that inhibits RAF phosphorylation and MEK activation. NST-628 also binds RAF and prevents the formation of BRAF-CRAF and BRAF-ARAF heterodimers, effectively inhibiting the RAS-MAPK pathway. NST-628 inhibits RAS- and RAF-driven cancers and demonstrated potent inhibition in mutant KRAS, NRAS, BRAF class II/III, and NF1-mutant tumors[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
NST-628 | 99.35% | NST-628 is a brain-permeable MAPK pathway molecule glue that inhibits RAF phosphorylation and MEK activation. NST-628 also binds RAF and prevents the formation of BRAF-CRAF and BRAF-ARAF heterodimers, effectively inhibiting the RAS-MAPK pathway. NST-628 inhibits RAS- and RAF-driven cancers and demonstrated potent inhibition in mutant KRAS, NRAS, BRAF class II/III, and NF1-mutant tumors. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||