300349-78-4
Chemical Structure
Bid BH3 peptide
- CAS No.: 300349-78-4
- Formula:C74H127N29O24S
- Molecular Weight:1839.05
InChIKey: XVCSJGXTFKBGFT-CJNKUVPHSA-N
SMILES: N=C(N)NCCC[C@H](N)C(N[C@@H](CC(N)=O)C(N[C@@H]([C@@H](C)CC)C(N[C@@H](C)C(N[C@@H](CCCNC(N)=N)C(N[C@H](C(N[C@@H](CC(C)C)C(N[C@@H](C)C(N[C@@H](CCC(N)=O)C(N[C@@H](C(C)C)C(NCC(N[C@@H](CC(O)=O)C(N[C@@H](CO)C(N[C@@H](CCSC)C(N[C@@H](CC(O)=O)C(N[C@H](C(O)=O)CCCNC(N)=N)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)CC1=CN=CN1)=O)=O)=O)=O)=O
Biological Activity: Bid BH3 peptide is a small peptide derived from Bid protein that can bind and activate the pro-apoptotic proteins Bax and Bak, leading to mitochondrial outer membrane permeabilization (MOMP) and apoptosis. Bid BH3 peptide can be used to study mitochondrial bioenergetics[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Bid BH3 peptide | Bid BH3 peptide is a small peptide derived from Bid protein that can bind and activate the pro-apoptotic proteins Bax and Bak, leading to mitochondrial outer membrane permeabilization (MOMP) and apoptosis. Bid BH3 peptide can be used to study mitochondrial bioenergetics. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
