3029695-07-3
Chemical Structure
SMU-L11
- CAS No.: 3029695-07-3
- Formula:C19H24N4O
- Molecular Weight:324.42
InChIKey: YRCAPNRYNCJHGV-UHFFFAOYSA-N
SMILES: CCCCC1=NC2=C(N1CC3CCOC3)C4=CC=CC=C4N=C2N
Biological Activity: SMU-L11 is a specific TLR7 agonist (EC50=0.024 μM), which recruits MyD88 adapter protein and activates downstream NF-κB and MAPK signaling pathways. In murine models, SMU-L11 significantly enhances immune cell activation and promotes the proliferation of CD4+ T and CD8+ T cells, thereby directly killing tumor cells and inhibiting tumor growth. SMU-L11 can be used for cancer research, and also has the potential for studying immune system diseases[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
SMU-L11 | 99.64% | SMU-L11 is a specific TLR7 agonist (EC50=0.024 μM), which recruits MyD88 adapter protein and activates downstream NF-κB and MAPK signaling pathways. In murine models, SMU-L11 significantly enhances immune cell activation and promotes the proliferation of CD4+ T and CD8+ T cells, thereby directly killing tumor cells and inhibiting tumor growth. SMU-L11 can be used for cancer research, and also has the potential for studying immune system diseases. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||