3033849-91-8
Chemical Structure
LCL-PEG3-N3 hydrochloride
- CAS No.: 3033849-91-8
- Formula:C32H46ClN7O6S
- Molecular Weight:692.27
IUPAC Name: (S)-N-((S)-2-((S)-2-(4-(3-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)benzoyl)thiazol-2-yl)pyrrolidin-1-yl)-1-cyclohexyl-2-oxoethyl)-2-(methylamino)propanamide hydrochloride
InChIKey: NWQPSYZPLYMFCN-KQBPGWGASA-N
SMILES: O=C(C1=CC(OCCOCCOCCN=[N+]=[N-])=CC=C1)C2=CSC([C@H]3N(C([C@H](C4CCCCC4)NC([C@H](C)NC)=O)=O)CCC3)=N2.[H]Cl
Biological Activity: LCL-PEG3-N3 (hydrochloride) is a decoy oligonucleotide ligand for E3 ligase which can be used for developing chimeric molecules LCL-ER(dec), degrading the estrogen receptor[1]. LCL-PEG3-N3 (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
LCL-PEG3-N3 hydrochloride | LCL-PEG3-N3 (hydrochloride) is a decoy oligonucleotide ligand for E3 ligase which can be used for developing chimeric molecules LCL-ER(dec), degrading the estrogen receptor. LCL-PEG3-N3 (hydrochloride) is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||