3036175-27-3
Chemical Structure
Npx-Au
- CAS No.: 3036175-27-3
- Formula:C35H31AuNO2P
- Molecular Weight:725.57
InChIKey: NOUIFXKHPKRYMU-JJRNEHELSA-O
SMILES: O=C([C@H](C1=CC2=C(C=C1)C=C(OC)C=C2)C)NCC#C[Au][P](C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5
Biological Activity: Npx-Au is a NSAID–Au(I) complex with antitumor activity. Npx-Au can be used for the research of ovarian cancer[1]. Npx-Au is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Npx-Au | Npx-Au is a NSAID–Au(I) complex with antitumor activity. Npx-Au can be used for the research of ovarian cancer. Npx-Au is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||