3095278-75-1
Chemical Structure
PI3Kα-IN-28
- CAS No.: 3095278-75-1
- Formula:C51H51ClF2N10O5S2
- Molecular Weight:1021.59
InChIKey: VSEHDERPEFENLT-RWYGWLOXSA-N
SMILES: CC1=C2C(C(OC3CCN(CC3)CC4CCN(CC4)C(C[C@@H]5N=C(C6=C(N7C5=NN=C7C)SC(C)=C6C)C8=CC=C(C=C8)Cl)=O)=CC(C9=CC(NS(C%10=CC=C(C=C%10F)F)(=O)=O)=C(N=C9)OC)=C2)=NC=N1
Biological Activity: PI3Kα-IN-28 (Compound 23) is an efficient dual targeted PI3K/BRD4 inhibitor. PI3Kα-IN-28 can inhibit the proliferation of various cells, such as KYSE180 and KYSE450 cells. PI3Kα-IN-28 can concentration dependently inhibit migration and colony formation, induce G0/G1 phase arrest, significantly inhibit DNA synthesis, and significantly increase the proportion of senescent cells. PI3Kα-IN-28 can inhibit the expression of p-AKT and c-Myc and activate the AMPK-p27 pathway. PI3Kα-IN-28 can be used for research on cancers such as esophageal cancer[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
PI3Kα-IN-28 | PI3Kα-IN-28 (Compound 23) is an efficient dual targeted PI3K/BRD4 inhibitor. PI3Kα-IN-28 can inhibit the proliferation of various cells, such as KYSE180 and KYSE450 cells. PI3Kα-IN-28 can concentration dependently inhibit migration and colony formation, induce G0/G1 phase arrest, significantly inhibit DNA synthesis, and significantly increase the proportion of senescent cells. PI3Kα-IN-28 can inhibit the expression of p-AKT and c-Myc and activate the AMPK-p27 pathway. PI3Kα-IN-28 can be used for research on cancers such as esophageal cancer. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
