316-07-4
Chemical Structure
Opromazine hydrochloride
- CAS No.: 316-07-4
- Formula:C17H20Cl2N2OS
- Molecular Weight:371.32
IUPAC Name: 2-chloro-10-(3-(dimethylamino)propyl)-10H-phenothiazine 5-oxide hydrochloride
InChIKey: VWLMLCOTJLYYST-UHFFFAOYSA-N
SMILES: O=S1C2=C(N(CCCN(C)C)C3=CC(Cl)=CC=C31)C=CC=C2.Cl
Biological Activity: Opromazine hydrochloride is an antipsychotic medication that exhibits sedative and antiemetic pharmacological effects, making it effective for treating psychiatric disorders such as schizophrenia and psychosis. Opromazine hydrochloride functions by reducing dopaminergic activity through the blockade of dopamine receptors in the brain. Opromazine hydrochloride has been analyzed for its metabolites in various microsomal enzymes, revealing differences in formation rates that underscore the variability of drug-metabolizing enzymes in human liver and placenta microsomes.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Opromazine hydrochloride | Opromazine hydrochloride is an antipsychotic medication that exhibits sedative and antiemetic pharmacological effects, making it effective for treating psychiatric disorders such as schizophrenia and psychosis. Opromazine hydrochloride functions by reducing dopaminergic activity through the blockade of dopamine receptors in the brain. Opromazine hydrochloride has been analyzed for its metabolites in various microsomal enzymes, revealing differences in formation rates that underscore the variability of drug-metabolizing enzymes in human liver and placenta microsomes. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||