32142-31-7
Chemical Structure
Vanillic acid glucoside
Synonym(s): Vanillic acid 4-β-D-glucoside
- CAS No.: 32142-31-7
- Formula:C14H18O9
- Molecular Weight:330.29
IUPAC Name: 3-methoxy-4-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)benzoic acid
InChIKey: JYFOSWJYZIVJPO-YGEZULPYSA-N
SMILES: O=C(O)C1=CC=C(O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)C(OC)=C1
Biological Activity: Vanillic acid glucoside (Vanillic acid 4-β-D-glucoside), a hydrolyzable tannin, is isolated from the fruits of C. annuum as well as the leaves of various additional plants. Vanillic acid glucoside can be phytotoxic against different species.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Vanillic acid glucoside | 98.18% | Vanillic acid glucoside (Vanillic acid 4-β-D-glucoside), a hydrolyzable tannin, is isolated from the fruits of C. annuum as well as the leaves of various additional plants. Vanillic acid glucoside can be phytotoxic against different species. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||