321724-19-0
Chemical Structure
Pyrimidine-5-boronic acid pinacol ester
- CAS. Nr.: 321724-19-0
- Formula:C10H15BN2O2
- Molecular Weight:206.05
IUPAC Name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine
InChIKey: WSRGGSAGSUEJKQ-UHFFFAOYSA-N
SMILES: CC1(C)OB(C2=CN=CN=C2)OC1(C)C
Biological Activity: Pyrimidine-5-boronic acid pinacol ester is a derivative of Boronic acid. Boronic acid is an intermediate commonly used in organic synthesis reactions and can be used as a key reagent in the Suzuki-Miyaura reaction. It generates organic free radicals through oxygen-mediated oxidation and exhibits potential mutagenic activity. Boronic acid is mainly used in research in the fields of drug synthesis and catalytic reactions. Pyrimidine-5-boronic acid pinacol ester serves as a building block in DNA-compatible one-pot click chemistry for synthesis of DNA-encoded libraries[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Pyrimidine-5-boronic acid pinacol ester | 98.0% | Pyrimidine-5-boronic acid pinacol ester is a derivative of Boronic acid. Boronic acid is an intermediate commonly used in organic synthesis reactions and can be used as a key reagent in the Suzuki-Miyaura reaction. It generates organic free radicals through oxygen-mediated oxidation and exhibits potential mutagenic activity. Boronic acid is mainly used in research in the fields of drug synthesis and catalytic reactions. Pyrimidine-5-boronic acid pinacol ester serves as a building block in DNA-compatible one-pot click chemistry for synthesis of DNA-encoded libraries. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||