345910-00-1
Chemical Structure
Methoxyacetic acid-d3
- CAS No.: 345910-00-1
- Formula:C3H3D3O3
- Molecular Weight:93.10
IUPAC Name: 2-(methoxy-d3)acetic acid
InChIKey: RMIODHQZRUFFFF-FIBGUPNXSA-N
SMILES: OC(COC([2H])([2H])[2H])=O
Biological Activity: Methoxyacetic acid-d3 is the deuterium labeled Methoxyacetic acid (HY-Y1009). Methoxyacetic acid is a metabolite of ethylene glycol monomethyl ether. When the concentration of methoxyacetic acid reaches a certain level, it can inhibit the respiratory function of hepatic mitochondria and testicular mitochondria. Methoxyacetic acid is somewhat toxic[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Methoxyacetic acid-d3 | Methoxyacetic acid-d3 is the deuterium labeled Methoxyacetic acid (HY-Y1009). Methoxyacetic acid is a metabolite of ethylene glycol monomethyl ether. When the concentration of methoxyacetic acid reaches a certain level, it can inhibit the respiratory function of hepatic mitochondria and testicular mitochondria. Methoxyacetic acid is somewhat toxic. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords