3475-65-8
Chemical Structure
Thiamine triphosphoric acid ester
Synonym(s): Thiamine triphosphate
- CAS. Nr.: 3475-65-8
- Formula:C12H19N4O10P3S
- Molecular Weight:504.29
IUPAC Name: 5-bromo-6-((4,5-dihydro-1H-imidazol-2-yl)amino)-1,4-dihydroquinoxaline-2,3-dione
InChIKey: IWLROWZYZPNOFC-UHFFFAOYSA-N
SMILES: O=P(O)(OP(O)(OP([O-])(OCCC1=C(C)[N+](CC2=CN=C(C)N=C2N)=CS1)=O)=O)O
Biological Activity: Thiamine triphosphoric acid ester (Thiamine triphosphate) is a neuroactive compound and a triphosphate derivative of vitamin thiamine. Thiamine triphosphoric acid ester exists in microorganisms, animal organs and plants. In E. coli, Thiamine triphosphoric acid ester is transiently produced under amino acid deficiency, while in mammalian cells, it is continuously produced at a low rate. Thiamine triphosphoric acid ester can be synthesized by two distinct enzymes (cytosolic AK1 and FoF1-ATP synthase in brain mitochondria). Thiamine triphosphoric acid ester plays a fundamental role in cellular metabolism or cellular signal transduction[1][2].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Thiamine triphosphoric acid ester | Thiamine triphosphoric acid ester (Thiamine triphosphate) is a neuroactive compound and a triphosphate derivative of vitamin thiamine. Thiamine triphosphoric acid ester exists in microorganisms, animal organs and plants. In E. coli, Thiamine triphosphoric acid ester is transiently produced under amino acid deficiency, while in mammalian cells, it is continuously produced at a low rate. Thiamine triphosphoric acid ester can be synthesized by two distinct enzymes (cytosolic AK1 and FoF1-ATP synthase in brain mitochondria). Thiamine triphosphoric acid ester plays a fundamental role in cellular metabolism or cellular signal transduction. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Makarchikov AF, et al. Thiamine triphosphate and thiamine triphosphatase activities: from bacteria to mammals. Cell Mol Life Sci. 2003;60(7):1477-1488. [Content Brief]
- [2]. Bettendorff L, et al. Thiamine triphosphate: a ubiquitous molecule in search of a physiological role. Metab Brain Dis. 2014;29(4):1069-1082. [Content Brief]
Keywords
