34769-44-3
Chemical Structure
Usnic acid sodium
- CAS No.: 34769-44-3
- Formula:C18H15NaO7
- Molecular Weight:366.30
IUPAC Name: sodium 4,8-diacetyl-1-hydroxy-2,9a-dimethyl-7,9-dioxo-7,8,9,9a-tetrahydrodibenzo[b,d]furan-3-olate
InChIKey: MKLQPOLHKMNWKN-UHFFFAOYSA-M
SMILES: O=C(C)C1=C(OC2=CC(C(C(C23C)=O)C(C)=O)=O)C3=C(O)C(C)=C1O[Na]
Biological Activity: Usnic acid sodium, a lichen-derived secondary metabolite, has a unique dibenzofuran skeleton. Usnic acid sodium has excellent anticancer and antimicrobial properties. Usnic acid sodium significantly inhibits RANKL-mediated osteoclast formation and function by reducing the transcriptional and translational expression of NFATc1[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Usnic acid sodium | Usnic acid sodium, a lichen-derived secondary metabolite, has a unique dibenzofuran skeleton. Usnic acid sodium has excellent anticancer and antimicrobial properties. Usnic acid sodium significantly inhibits RANKL-mediated osteoclast formation and function by reducing the transcriptional and translational expression of NFATc1. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||