36455-72-8
36455-72-8
Chemical Structure
α-Zearalenol
- CAS No.: 36455-72-8
- Formula:C18H24O5
- Molecular Weight:320.38
SMILES: OC1=C2C(O[C@H](CCC[C@@H](CCC/C=C/C2=CC(O)=C1)O)C)=O
Biological Activity: α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER), α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
α-Zearalenol | 99.73% | α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER), α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Zearalenol (Standard) | ≥98% | α-Zearalenol (Standard) is the analytical standard of α-Zearalenol. This product is intended for research and analytical applications. α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER), α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Zearalenol-d4 | α-Zearalenol-d4 is a deuterated labeled α-Zearalenol. α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER), α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Alpha-Zearalenol-d7 | Alpha-Zearalenol-d7 is the deuterium labeled α-Zearalenol (HY-N6710). α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER). α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
α-Zearalenol-13C18 | α-Zearalenol-13C18 is the 13C-labeled α-Zearalenol. α-Zearalenol is a Mycotoxin with high affinity for the estrogen receptors (ER). α-Zearalenol is the derivative of zearalenone (ZEN), causes reproductive disorders in animals, due to its xenoestrogenic effects. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
References
