3681-93-4
Chemical Structure
Vitexin
- CAS No.: 3681-93-4
- Formula:C21H20O10
- Molecular Weight:432.38
IUPAC Name: 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)-4H-chromen-4-one
InChIKey: SGEWCQFRYRRZDC-VPRICQMDSA-N
SMILES: OC1=CC=C(C2=CC(C(C(O)=CC(O)=C3[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O4)=C3O2)=O)C=C1
Biological Activity: Vitexin is a c-glycosylated flavone, and is found in various medicinal plants species such as Trigonella foenum-graecum Linn. Vitexin has a wide range of pharmacological effects, including anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Vitexin | 99.48% | Vitexin is a c-glycosylated flavone, and is found in various medicinal plants species such as Trigonella foenum-graecum Linn. Vitexin has a wide range of pharmacological effects, including anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Vitexin (Standard) | 98.21% | Vitexin (Standard) is the analytical standard of Vitexin. This product is intended for research and analytical applications. Vitexin is a c-glycosylated flavone, and is found in various medicinal plants species such as Trigonella foenum-graecum Linn. Vitexin has a wide range of pharmacological effects, including anti-oxidant, anti-cancer, anti-inflammatory, anti-hyperalgesic, and neuroprotective effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||