370-81-0
Chemical Structure
Cuprizone
- CAS No.: 370-81-0
- Formula:C14H22N4O2
- Molecular Weight:278.36
IUPAC Name: N'1,N'2-dicyclohexylideneoxalohydrazide
InChIKey: DSRJIHMZAQEUJV-UHFFFAOYSA-N
SMILES: O=C(C(N/N=C1CCCCC\1)=O)N/N=C2CCCCC/2
Biological Activity: Cuprizone is a copper chelating agent that forms a deep blue copper ketone complex with copper (II). The copper ketone reaction can be used in colorimetric tests for the presence of trace copper. Cuprizone can be used to induce some schizophrenia-like behavior in mice. Cuprizone acts on copper enzymes, including SOD1, cytochrome oxidase, and DβH, thereby causing oxidative stress and increasing DA levels in certain brain regions such as the medial prefrontal cortex (PFC)[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Cuprizone | 99.61% | Cuprizone is a copper chelating agent that forms a deep blue copper ketone complex with copper (II). The copper ketone reaction can be used in colorimetric tests for the presence of trace copper. Cuprizone can be used to induce some schizophrenia-like behavior in mice. Cuprizone acts on copper enzymes, including SOD1, cytochrome oxidase, and DβH, thereby causing oxidative stress and increasing DA levels in certain brain regions such as the medial prefrontal cortex (PFC). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Cuprizone (Standard) | ≥98% | Cuprizone is a copper chelating agent that forms a deep blue copper ketone complex with copper (II). The copper ketone reaction can be used in colorimetric tests for the presence of trace copper. Cuprizone can be used to induce some schizophrenia-like behavior in mice. Cuprizone acts on copper enzymes, including SOD1, cytochrome oxidase, and DβH, thereby causing oxidative stress and increasing DA levels in certain brain regions such as the medial prefrontal cortex (PFC). | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords