375-92-8
Chemical Structure
Perfluoroheptanesulfonic acid
Synonym(s): 1-Perfluoroheptanesulfonic acid; Perfluoroheptanesulphonic acid; PFHpS
- CAS No.: 375-92-8
- Formula:C7HF15O3S
- Molecular Weight:450.12
IUPAC Name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid
InChIKey: OYGQVDSRYXATEL-UHFFFAOYSA-N
SMILES: O=S(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(O)=O
Biological Activity: Perfluoroheptanesulfonic acid (1-Perfluoroheptanesulfonic acid; Perfluoroheptanesulphonic acid) is a perfluoroalkyl substance (PFAS). PFHpS can induce malformations in zebrafish larvae (EC50=168.1 μM). It has also been found in landfill leachate, and fetal exposure to PFHpS can lead to reduced birth weight.
| Cat. No. | 상품명 | Purity | 제품 설명 | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Perfluoroheptanesulfonic acid | Perfluoroheptanesulfonic acid (1-Perfluoroheptanesulfonic acid; Perfluoroheptanesulphonic acid) is a perfluoroalkyl substance (PFAS). PFHpS can induce malformations in zebrafish larvae (EC50=168.1 μM). It has also been found in landfill leachate, and fetal exposure to PFHpS can lead to reduced birth weight. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
