414909-09-4
Chemical Structure
RTC14
- CAS No.: 414909-09-4
- Formula:C17H18N2O3
- Molecular Weight:298.34
IUPAC Name: (E)-4-(tert-butyl)-2-((3-nitrobenzylidene)amino)phenol
InChIKey: SRROYBWFBCWHGV-WOJGMQOQSA-N
SMILES: OC1=CC=C(C=C1/N=C/C2=CC=CC([N+]([O-])=O)=C2)C(C)(C)C
Biological Activity: RTC14 is a read-through compound (RTC) that can induce ribosomes to bypass nonsense mutations in mRNA and allow the production of full-length functional proteins. RTC14 has the potential to be used in the research of various genetic disorders, such as nonsense mutations in the ataxia-telangiectasia mutated (ATM) gene and the dystrophin gene[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
RTC14 | RTC14 is a read-through compound (RTC) that can induce ribosomes to bypass nonsense mutations in mRNA and allow the production of full-length functional proteins. RTC14 has the potential to be used in the research of various genetic disorders, such as nonsense mutations in the ataxia-telangiectasia mutated (ATM) gene and the dystrophin gene. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||