415724-84-4
Chemical Structure
Poricoic acid G
- CAS No.: 415724-84-4
- Formula:C30H46O5
- Molecular Weight:486.68
IUPAC Name: (R)-2-((2R,3R,3aR,6S,7S,9bR)-6-(2-carboxyethyl)-2-hydroxy-3a,6,9b-trimethyl-7-(prop-1-en-2-yl)-2,3,3a,4,5,6,7,8,9,9b-decahydro-1H-cyclopenta[a]naphthalen-3-yl)-6-methylhept-5-enoic acid
InChIKey: VPTZOSBKEDUOFE-KXGBKNTBSA-N
SMILES: C/C(C)=C\CC[C@@H](C(O)=O)[C@H]1[C@H](O)C[C@]2(C)[C@]1(C)CCC3=C2CC[C@@H](C(C)=C)[C@@]3(CCC(O)=O)C
Biological Activity: Poricoic acid G is a triterpenoid that can be isolated from Poria cocos. Poricoic acid G has a significant cytotoxic effect on leukemia cells and is a potential potent anti-leukemic compound in humans[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Poricoic acid G | Poricoic acid G is a triterpenoid that can be isolated from Poria cocos. Poricoic acid G has a significant cytotoxic effect on leukemia cells and is a potential potent anti-leukemic compound in humans. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||