43150-64-7
Chemical Structure
Adenosyl-(3′→5′)-uridine sodium
Synonym(s): ApU sodium
- CAS No.: 43150-64-7
- Formula:C19H23N7NaO12P
- Molecular Weight:595.39
SMILES: NC1=NC=NC2=C1N=CN2[C@H]3[C@H](O)[C@H](OP(OC[C@H]4O[C@@H](N5C(NC(C=C5)=O)=O)[C@H](O)[C@@H]4O)(O[Na])=O)[C@@H](CO)O3
Biological Activity: Adenosyl-(3′→5′)-uridine (ApU) sodium is a nucleotide, which is composed of an adenine base and a uracil sugar molecule through a 3'-5' phosphodiester bond. Adenosyl-(3′→5′)-uridine (ApU) sodium participates in the biological processes, such as gene expression regulation, signal transduction, and protein synthesis[1].
| Cat. No. | Nom du produit | Pureté | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Adenosyl-(3′→5′)-uridine sodium | Adenosyl-(3′→5′)-uridine (ApU) sodium is a nucleotide, which is composed of an adenine base and a uracil sugar molecule through a 3'-5' phosphodiester bond. Adenosyl-(3′→5′)-uridine (ApU) sodium participates in the biological processes, such as gene expression regulation, signal transduction, and protein synthesis. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords