480-70-6
Chemical Structure
(E/Z)-Aureusidin
- CAS. Nr.: 480-70-6
- Formula:C15H10O6
- Molecular Weight:286.24
InChIKey: WBEFUVAYFSOUEA-YIXHJXPBSA-N
SMILES: O=C1/C(OC2=C1C(O)=CC(O)=C2)=C\C3=CC=C(C(O)=C3)O
Biological Activity: (E/Z)-Aureusidin is a flavonoid compound with antioxidant activity. (E/Z)-Aureusidin can inhibit the production of reactive oxygen species and reduce cell damage. (E/Z)-Aureusidin has anti-inflammatory effects and can reduce the expression of inflammatory factors. (E/Z)-Aureusidin has inhibitory effects on a variety of bacteria, indicating its potential antimicrobial properties[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
(E/Z)-Aureusidin | (E/Z)-Aureusidin is a flavonoid compound with antioxidant activity. (E/Z)-Aureusidin can inhibit the production of reactive oxygen species and reduce cell damage. (E/Z)-Aureusidin has anti-inflammatory effects and can reduce the expression of inflammatory factors. (E/Z)-Aureusidin has inhibitory effects on a variety of bacteria, indicating its potential antimicrobial properties. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords