51166-71-3
Chemical Structure
DM-β-CD
Synonym(s): 2,6-Di-O-methyl-β-cyclodextrin
- CAS No.: 51166-71-3
- Formula:C56H98O35
- Molecular Weight:1331.36
InChIKey: QGKBSGBYSPTPKJ-UZMKXNTCSA-N
SMILES: COC[C@@H](O[C@@](O[C@]([C@@H]1O)([H])[C@H](O[C@@](O[C@]([C@@H]2O)([H])[C@H](O[C@@](O[C@]([C@@H]([C@H]3OC)O)([H])[C@H]4COC)([H])[C@@H]2OC)COC)([H])[C@@H]1OC)COC)([H])[C@@H]5OC)[C@](O[C@](O[C@@H]6COC)([H])[C@@H]([C@H]([C@]6([H])O[C@](O[C@@H]7COC)([H])[C@@H]([C@H]([C@]7([H])O[C@](O[C@@H]8COC)([H])[C@@H]([C@H]([C@]8([H])O[C@@]3([H])O4)O)OC)O)OC)O)OC)([H])[C@@H]5O
Biological Activity: DM-β-CD (2,6-Di-O-methyl-β-cyclodextrin) is a cyclic molecule consisting of seven glucose units modified with two methyl groups at the 2- and 6-positions. It is usually used as a solubilizer and carrier for poorly soluble drugs in pharmaceutical preparations. Furthermore, it has applications in analytical chemistry, food science, and environmental remediation due to its ability to form clathrates with various guest molecules, such as aromatic compounds, pesticides, and heavy metals.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
DM-β-CD | 98.0% | DM-β-CD (2,6-Di-O-methyl-β-cyclodextrin) is a cyclic molecule consisting of seven glucose units modified with two methyl groups at the 2- and 6-positions. It is usually used as a solubilizer and carrier for poorly soluble drugs in pharmaceutical preparations. Furthermore, it has applications in analytical chemistry, food science, and environmental remediation due to its ability to form clathrates with various guest molecules, such as aromatic compounds, pesticides, and heavy metals. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords