531-55-5
Chemical Structure
Azure B
Synonym(s): Azure B chloride
- CAS No.: 531-55-5
- Formula:C15H16ClN3S
- Molecular Weight:305.83
IUPAC Name: 3-(dimethylamino)-7-(methylamino)phenothiazin-5-ium chloride
InChIKey: KFZNPGQYVZZSNV-UHFFFAOYSA-M
SMILES: CNC1=CC2=[S+]C3=C(C=CC(N(C)C)=C3)N=C2C=C1.[Cl-]
Biological Activity: Azure B is a cationic dye and the major metabolite of Methylene blue. Azure B is used in making Azure eosin stains for blood smear staining. Azure B is a high-potency, selective and reversible inhibitor of monoamine oxidases (MAO)-A, with IC50s of 11 and 968 nM for recombinant human MAO-A and MAO-B, respectively. Azure B possesses significant antidepressant-like effects[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Azure B | 99.87% | Azure B is a cationic dye and the major metabolite of Methylene blue. Azure B is used in making Azure eosin stains for blood smear staining. Azure B is a high-potency, selective and reversible inhibitor of monoamine oxidases (MAO)-A, with IC50s of 11 and 968 nM for recombinant human MAO-A and MAO-B, respectively. Azure B possesses significant antidepressant-like effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Azure B (Standard) | ≥98% | Azure B (Standard) is the analytical standard of Azure B. This product is intended for research and analytical applications. Azure B is a cationic dye and the major metabolite of Methylene blue. Azure B is used in making Azure eosin stains for blood smear staining. Azure B is a high-potency, selective and reversible inhibitor of monoamine oxidases (MAO)-A, with IC50s of 11 and 968 nM for recombinant human MAO-A and MAO-B, respectively. Azure B possesses significant antidepressant-like effects. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Löhr W,et al. The azure dyes: their purification and physicochemical properties. II. Purification of azure B. Stain Technol. 1975 May;50(3):149-56. [Content Brief]
- [2]. Delport A, et al. Azure B and a synthetic structural analogue of methylene blue, ethylthioninium chloride, present with antidepressant-like properties. Life Sci. 2014 Nov 11;117(2):56-66. [Content Brief]
Keywords