544467-07-4
Chemical Structure
HIV-1 integrase inhibitor
- CAS No.: 544467-07-4
- Formula:C11H9N3O4
- Molecular Weight:247.21
IUPAC Name: (Z)-4-(3-(azidomethyl)phenyl)-2-hydroxy-4-oxobut-2-enoic acid
InChIKey: DWAUHOPROZDIJR-YHYXMXQVSA-N
SMILES: OC(/C(O)=C/C(C1=CC=CC(CN=[N+]=[N-])=C1)=O)=O
Biological Activity: HIV-1 integrase inhibitor is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
HIV-1 integrase inhibitor | 97.06% | HIV-1 integrase inhibitor is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||