55481-90-8
Chemical Structure
Laricitrin 3-rutinoside
Synonym(s): Laricitrin 3-O-rutinoside
- CAS. Nr.: 55481-90-8
- Formula:C28H32O17
- Molecular Weight:640.55
IUPAC Name: 2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-3-(((2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-((((2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)methyl)tetrahydro-2H-pyran-2-yl)oxy)-4H-chromen-4-one
InChIKey: IEPKWJCBNGNVDF-WQIPHUEGSA-N
SMILES: O(C1=C(OC=2C(C1=O)=C(O)C=C(O)C2)C3=CC(OC)=C(O)C(O)=C3)[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O5)[C@@H](O)[C@H](O)[C@H]4O
Biological Activity: Laricitrin 3-rutinoside (Laricitrin 3-O-rutinoside) is a flavonol rutin. Laricitrin 3-rutinoside can be isolated from the fruits of Ginkgo biloba. Laricitrin 3-rutinoside inhibits ERK phosphorylation, reactive oxygen species (ROS) production, and matrix metalloproteinase-1 (MMP-1) secretion. Laricitrin 3-rutinoside inhibits Collagen degradation. Laricitrin 3-rutinoside reduces the secretion of proinflammatory cytokines interleukin 6 (IL-6) and interleukin 8 (IL-8). Laricitrin 3-rutinoside is applicable to research related to skin aging[1].
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Laricitrin 3-rutinoside | Laricitrin 3-rutinoside (Laricitrin 3-O-rutinoside) is a flavonol rutin. Laricitrin 3-rutinoside can be isolated from the fruits of Ginkgo biloba. Laricitrin 3-rutinoside inhibits ERK phosphorylation, reactive oxygen species (ROS) production, and matrix metalloproteinase-1 (MMP-1) secretion. Laricitrin 3-rutinoside inhibits Collagen degradation. Laricitrin 3-rutinoside reduces the secretion of proinflammatory cytokines interleukin 6 (IL-6) and interleukin 8 (IL-8). Laricitrin 3-rutinoside is applicable to research related to skin aging. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
