58591-23-4
Chemical Structure
Candicidin A3
Synonym(s): FR-008I
- CAS No.: 58591-23-4
- Formula:C59H86N2O18
- Molecular Weight:1111.32
IUPAC Name: (10R,12S,14S,18S,19S,20S,22R,23E,25E,27E,29Z,31Z,33E,35E,37S,38R)-22-(((2R,3S,4S,5S,6R)-4-amino-3,5-dihydroxy-6-methyltetrahydro-2H-pyran-2-yl)oxy)-38-((2S,4S,5S)-7-(4-aminophenyl)-5-hydroxy-4-methyl-7-oxoheptan-2-yl)-4,10,12,14,18,20-hexahydroxy-37-methyl-2,8,16-trioxooxacyclooctatriaconta-23,25,27,29,31,33,35-heptaene-19-carboxylic acid
InChIKey: BVEQUWMYNKLPDF-SJCAJVGYSA-N
SMILES: C[C@@H](C[C@H](C)[C@H]1OC(CC(O)CCCC(C[C@H](O)C[C@H](O)C[C@H](O)CC(C[C@H](O)[C@H]([C@@H](O)C[C@@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](N)[C@@H]2O)/C=C/C=C/C=C/C=C\C=C/C=C/C=C/[C@@H]1C)C(O)=O)=O)=O)=O)[C@@H](O)CC(C3=CC=C(C=C3)N)=O
Biological Activity: Candicidin A3 (FR-008I) is an antifungal antibiotic with significant biological activity. Candicidin A3 can effectively inhibit the growth of fungi through its unique three-dimensional structure and seven-membered ring geometry. The absolute configuration of Candicidin A3 is a specific arrangement of multiple chiral centers, which may affect its biological activity and interaction with targets. Candicidin A3 can be used as a potential drug to inhibit fungal infections[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Candicidin A3 | Candicidin A3 (FR-008I) is an antifungal antibiotic with significant biological activity. Candicidin A3 can effectively inhibit the growth of fungi through its unique three-dimensional structure and seven-membered ring geometry. The absolute configuration of Candicidin A3 is a specific arrangement of multiple chiral centers, which may affect its biological activity and interaction with targets. Candicidin A3 can be used as a potential drug to inhibit fungal infections. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||