62192-83-0
Chemical Structure
2'-Azido-dCTP
- CAS No.: 62192-83-0
- Formula:C9H15N6O13P3
- Molecular Weight:508.17
InChIKey: HWSNFUNJICGTGY-XVFCMESISA-N
SMILES: O[C@H]1[C@@H](N=[N+]=[N-])[C@H](N2C(N=C(N)C=C2)=O)O[C@@H]1COP(OP(OP(O)(O)=O)(O)=O)(O)=O
Biological Activity: 2'-Azido-dCTP is a modified deoxynucleotide substrate for the 24-3 polymerase ribozyme. 2'-Azido-dCTP is incorporated at the terminus of the template-bound primer and supports downstream azide-mediated click chemistry functionalization. 2'-Azido-dCTP is efficiently incorporated under standard labeling conditions, and increasing the substrate concentration or extending the reaction time only slightly improves the yield[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2'-Azido-dCTP | 2'-Azido-dCTP is a modified deoxynucleotide substrate for the 24-3 polymerase ribozyme. 2'-Azido-dCTP is incorporated at the terminus of the template-bound primer and supports downstream azide-mediated click chemistry functionalization. 2'-Azido-dCTP is efficiently incorporated under standard labeling conditions, and increasing the substrate concentration or extending the reaction time only slightly improves the yield. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
