63451-35-4
Chemical Structure
Hydroxynaphthol Blue
- CAS No.: 63451-35-4
- Formula:C20H11N2Na3O11S3
- Molecular Weight:620.47
IUPAC Name: sodium (E)-3-hydroxy-4-((2-hydroxy-4-sulfonatonaphthalen-1-yl)diazenyl)naphthalene-2,7-disulfonate
InChIKey: AUIINJJXRXMPGT-ZRUFZDNISA-K
SMILES: O=S(C1=C(O)C(/N=N/C2=C3C=CC=CC3=C(S(=O)(O[Na])=O)C=C2O)=C4C=CC(S(=O)(O[Na])=O)=CC4=C1)(O[Na])=O
Biological Activity:
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Hydroxynaphthol Blue | 95.0% | Hydroxynaphthol Blue is an azo dye and serves as a metal indicator. Hydroxynaphthol Blue binds to specific metal ions to form stable complexes with distinct color and fluorescence properties. Hydroxynaphthol Blue is used for the visual monitoring of isothermal nucleic acid amplification results. A visible color difference appears between positive and negative nucleic acid amplification reactions, allowing result discrimination by the naked eye without opening the reaction tube. |
||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords