64038-56-8
Chemical Structure
Dacarbazine citrate
Synonym(s): Imidazole Carboxamide citrate
- CAS No.: 64038-56-8
- Formula:C12H18N6O8
- Molecular Weight:374.31
IUPAC Name: (E)-5-(3,3-dimethyltriaz-1-en-1-yl)-1H-imidazole-4-carboxamide 2-hydroxypropane-1,2,3-tricarboxylate
InChIKey: UKLSKIDEWQXQJZ-ASTDGNLGSA-N
SMILES: O=C(C1=C(/N=N/N(C)C)NC=N1)N.O=C(CC(C(O)=O)(O)CC(O)=O)O
Biological Activity: Dacarbazine citrate is a cell cycle nonspecific antineoplastic alkylating agent. Dacarbazine citrate inhibits T and B lymphoblastic response, with IC50 values of 50 and 10 μg/mL, respectively. Dacarbazine Citrate can be used for the research of apoptosis and various cancers such as metastatic malignant melanoma[1][2].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Dacarbazine citrate | Dacarbazine citrate is a cell cycle nonspecific antineoplastic alkylating agent. Dacarbazine citrate inhibits T and B lymphoblastic response, with IC50 values of 50 and 10 μg/mL, respectively. Dacarbazine Citrate can be used for the research of apoptosis and various cancers such as metastatic malignant melanoma. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||