640725-76-4
Chemical Structure
2’-β-C-Ethynyladenosine
- CAS. Nr.: 640725-76-4
- Formula:C12H13N5O4
- Molecular Weight:291.26
IUPAC Name: (2R,3R,4R,5R)-2-(6-amino-9H-purin-9-yl)-3-ethynyl-5-(hydroxymethyl)tetrahydrofuran-3,4-diol
InChIKey: GLMZHZQENASCGE-YUTYNTIBSA-N
SMILES: O[C@@H]1[C@@H](CO)O[C@@H](N2C(N=CN=C3N)=C3N=C2)[C@]1(C#C)O
Biological Activity: 2’-β-C-Ethynyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. 2’-β-C-Ethynyladenosine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups.
| Art. -Nr. | Produktname | Reinheit | Beschreibung | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
2’-β-C-Ethynyladenosine | 2’-β-C-Ethynyladenosine is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc. 2’-β-C-Ethynyladenosine is a click chemistry reagent, it contains an Alkyne group and can undergo copper-catalyzed azide-alkyne cycloaddition (CuAAc) with molecules containing Azide groups. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||