66395-03-7
Chemical Structure
Chloranthalactone B
- CAS No.: 66395-03-7
- Formula:C15H16O3
- Molecular Weight:244.29
IUPAC Name: (1aS,5aS,6aS,7aR,7bS,7cS)-4,7b-dimethyl-6-methylene-5,5a,6,6a,7,7a,7b,7c-octahydro-3H-cyclopropa[2,3]oxireno[2',3':4,5]indeno[5,6-b]furan-3-one
InChIKey: ZKAVFYQAEVFXTE-NRLMIDHWSA-N
SMILES: C[C@@]12[C@@]3([H])[C@]4(O3)C(C[C@@]1([H])C([C@]5([H])[C@@]2([H])C5)=C)=C(C(O4)=O)C
Biological Activity: Chloranthalactone B, a lindenane-type sesquiterpenoid, is a nature product that could be isolated from Chinese medicinal herb Sarcandra glabra. Chloranthalactone B inhibits the production of inflammatory mediators by inhibiting the AP-1 and p38 MAPK pathways[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Chloranthalactone B | Chloranthalactone B, a lindenane-type sesquiterpenoid, is a nature product that could be isolated from Chinese medicinal herb Sarcandra glabra. Chloranthalactone B inhibits the production of inflammatory mediators by inhibiting the AP-1 and p38 MAPK pathways. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||