67047-17-0
Chemical Structure
TOP3B-IN-1
- CAS No.: 67047-17-0
- Formula:C34H34N4O2
- Molecular Weight:530.66
SMILES: COC1=CC2=NC3=C(C=CC=C3)C(NCCCCCCNC4=C5C=CC(OC)=CC5=NC6=C4C=CC=C6)=C2C=C1
Biological Activity: TOP3B-IN-1 (NSC-260610) is a Topoisomerase IIIβ (TOP3B) inhibitor. TOP3B-IN-1 fails to induce the formation of TOP3B cleavage complexes (TOP3Bccs) with both DNA and RNA, and destabilizes TOP3Bccs. TOP3B-IN-1 can be used as a control compound for the development of inhibitors targeting TOP3B[1].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
TOP3B-IN-1 | TOP3B-IN-1 (NSC-260610) is a Topoisomerase IIIβ (TOP3B) inhibitor. TOP3B-IN-1 fails to induce the formation of TOP3B cleavage complexes (TOP3Bccs) with both DNA and RNA, and destabilizes TOP3Bccs. TOP3B-IN-1 can be used as a control compound for the development of inhibitors targeting TOP3B. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||