676-46-0
Chemical Structure
Malic acid disodium salt
Synonym(s): Hydroxybutanedioic acid disodium salt; E 296 disodium salt
- CAS No.: 676-46-0
- Formula:C4H4Na2O5
- Molecular Weight:178.05
IUPAC Name: sodium 2-hydroxysuccinate
InChIKey: WPUMTJGUQUYPIV-UHFFFAOYSA-L
SMILES: O=C(CC(C(O[Na])=O)O)O[Na]
Biological Activity: Sodium DL-Malate is an organic compound commonly used as a food additive, buffer and nutritional supplement. It contains sodium and malic acid. Malic acid disodium salt has several properties suitable for these applications, including the ability to enhance food flavor, improve texture and regulate acidity. Additionally, it can be used as a dietary supplement due to its potential health benefits, including improved energy production, reduced fatigue, and enhanced athletic performance.
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Malic acid disodium salt | 99.04% | Sodium DL-Malate is an organic compound commonly used as a food additive, buffer and nutritional supplement. It contains sodium and malic acid. Malic acid disodium salt has several properties suitable for these applications, including the ability to enhance food flavor, improve texture and regulate acidity. Additionally, it can be used as a dietary supplement due to its potential health benefits, including improved energy production, reduced fatigue, and enhanced athletic performance. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
Keywords
