69-93-2
Chemical Structure
Uric acid
- No. CAS: 69-93-2
- Formula:C5H4N4O3
- Molecular Weight:168.11
IUPAC Name: 7,9-dihydro-1H-purine-2,6,8(3H)-trione
InChIKey: LEHOTFFKMJEONL-UHFFFAOYSA-N
SMILES: O=C(N1)NC2=C(NC(N2)=O)C1=O
Biological Activity: Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation[1][2].
| Referencia número | Nombre del producto | Pureza | Descripciòn | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Uric acid | 99.92% | Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid (Standard) | 99.98% | Uric acid (Standard) is the analytical standard of Uric acid. This product is intended for research and analytical applications. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid-13C,15N3 | Uric acid-13C,15N3 is the 13C-labeled and 15N-labeled Uric acid. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid-15N2 | 99.95% | Uric acid-15N2 is the 15N labeled Uric acid. Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Uric acid-13C | Uric acid-13C is the 13C-labeled Uric acid (HY-B2130). Uric acid, scavenger of oxygen radical, is a very important antioxidant that help maintains the stability of blood pressure and antioxidant stress. Uric acid can remove reactive oxygen species (ROS) such as singlet oxygen and peroxynitrite, inhibiting lipid peroxidation. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
- [1]. Wang Q, et al. Recent Progress on Uric Acid Detection: A Review. Crit Rev Anal Chem. 2020;50(4):359-375. [Content Brief]
- [2]. Yasutake Y, et al. Uric acid ameliorates indomethacin-induced enteropathy in mice through its antioxidant activity. J Gastroenterol Hepatol. 2017 Nov;32(11):1839-1845. [Content Brief]