70155-52-1
70155-52-1
Chemical Structure
Baclofen-d4-1
- CAS No.: 70155-52-1
- Formula:C10H8D4ClNO2
- Molecular Weight:217.69
InChIKey: KPYSYYIEGFHWSV-NZLXMSDQSA-N
SMILES: NC([2H])(C(C1=CC=C(C=C1)Cl)C([2H])(C(O)=O)[2H])[2H]
Biological Activity: Baclofen-d4-1 is the deuterium labeled Baclofen (HY-B0007). Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research[1][2][3].
| Cat. No. | Product Name | Purity | Description | Pricing | |||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
|
|
Baclofen-d4-1 | Baclofen-d4-1 is the deuterium labeled Baclofen (HY-B0007). Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Baclofen (Standard) | ≥98% | Baclofen (Standard) is the analytical standard of Baclofen. This product is intended for research and analytical applications. Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Baclofen-d5 hydrochloride | Baclofen-d5 hydrochloride is deuterated labeled Baclofen (HY-B0007). Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research. | |||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Baclofen-d4 | 99.98% | Baclofen-d4 is the deuterium labeled Baclofen. Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
|
|
Baclofen | 99.98% | Baclofen, a lipophilic derivative of γ-aminobutyric acid (GABA), is an orally active, selective metabotropic GABAB receptor (GABABR) agonist with blood-brain barrier permeability. Baclofen mimics the action of GABA and produces slow presynaptic inhibition through the GABAB receptor. Baclofen has high blood brain barrier penetrance. Baclofen has the potential for muscle spasticity research. | ||||||||||||||||||||
|
loading...
/
|
|||||||||||||||||||||||
